C20H20F2N6O4 — CID 119039875
2-[[2-amino-6-[[2-(4-fluorophenyl)-2-hydroxyethyl]amino]-5-nitropyrimidin-4-yl]amino]-1-(4-fluorophenyl)ethanol (PubChem CID 119039875) has the molecular formula C20H20F2N6O4 and a molecular weight of 446.41 g/mol. Its IUPAC name is 2-[[2-amino-6-[[2-(4-fluorophenyl)-2-hydroxyethyl]amino]-5-nitropyrimidin-4-yl]amino]-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-[[2-amino-6-[[2-(4-fluorophenyl)-2-hydroxyethyl]amino]-5-nitropyrimidin-4-yl]amino]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 119039875 |
| Molecular Formula | C20H20F2N6O4 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-[[2-amino-6-[[2-(4-fluorophenyl)-2-hydroxyethyl]amino]-5-nitropyrimidin-4-yl]amino]-1-(4-fluorophenyl)ethanol |
| SMILES | Nc1nc(NCC(O)c2ccc(F)cc2)c([N+](=O)[O-])c(NCC(O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H20F2N6O4/c21-13-5-1-11(2-6-13)15(29)9-24-18-17(28(31)32)19(27-20(23)26-18)25-10-16(30)12-3-7-14(22)8-4-12/h1-8,15-16,29-30H,9-10H2,(H4,23,24,25,26,27) |
| InChIKey | IOLRYADHDAHFIO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|