C18H13F2N3O4 — CID 134362734
ethyl 3-[(5,7-difluoroquinolin-4-yl)amino]-2-nitrobenzoate (PubChem CID 134362734) has the molecular formula C18H13F2N3O4 and a molecular weight of 373.32 g/mol. Its IUPAC name is ethyl 3-[(5,7-difluoroquinolin-4-yl)amino]-2-nitrobenzoate.
| Compound Name | ethyl 3-[(5,7-difluoroquinolin-4-yl)amino]-2-nitrobenzoate |
|---|---|
| PubChem CID | 134362734 |
| Molecular Formula | C18H13F2N3O4 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | ethyl 3-[(5,7-difluoroquinolin-4-yl)amino]-2-nitrobenzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ccnc3cc(F)cc(F)c23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13F2N3O4/c1-2-27-18(24)11-4-3-5-14(17(11)23(25)26)22-13-6-7-21-15-9-10(19)8-12(20)16(13)15/h3-9H,2H2,1H3,(H,21,22) |
| InChIKey | MNCUTTVKEHASML-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|