C16H26N4O2 — CID 122061674
2-[[3-[(4-tert-butylpyrimidin-2-yl)amino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122061674) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[[3-[(4-tert-butylpyrimidin-2-yl)amino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[(4-tert-butylpyrimidin-2-yl)amino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122061674 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-[[3-[(4-tert-butylpyrimidin-2-yl)amino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(Nc2nccc(C(C)(C)C)n2)C1 |
| InChI | InChI=1S/C16H26N4O2/c1-5-20(10-14(21)22)12-8-11(9-12)18-15-17-7-6-13(19-15)16(2,3)4/h6-7,11-12H,5,8-10H2,1-4H3,(H,21,22)(H,17,18,19) |
| InChIKey | XVCJBBYDLJNOFI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |