C13H15FN2O7 — CID 122060946
3-(2-ethoxycarbonyl-6-fluoro-4-nitroanilino)-2-hydroxy-2-methylpropanoic acid (PubChem CID 122060946) has the molecular formula C13H15FN2O7 and a molecular weight of 330.27 g/mol. Its IUPAC name is 3-(2-ethoxycarbonyl-6-fluoro-4-nitroanilino)-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-(2-ethoxycarbonyl-6-fluoro-4-nitroanilino)-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122060946 |
| Molecular Formula | C13H15FN2O7 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-(2-ethoxycarbonyl-6-fluoro-4-nitroanilino)-2-hydroxy-2-methylpropanoic acid |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])cc(F)c1NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C13H15FN2O7/c1-3-23-11(17)8-4-7(16(21)22)5-9(14)10(8)15-6-13(2,20)12(18)19/h4-5,15,20H,3,6H2,1-2H3,(H,18,19) |
| InChIKey | JRUHWBNXEMEILT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|