C10H9FN2O3 — CID 174449925
6-fluoro-8-nitro-1,2,3,4-tetrahydroquinoline-4-carbaldehyde (PubChem CID 174449925) has the molecular formula C10H9FN2O3 and a molecular weight of 224.19 g/mol. Its IUPAC name is 6-fluoro-8-nitro-1,2,3,4-tetrahydroquinoline-4-carbaldehyde.
| Compound Name | 6-fluoro-8-nitro-1,2,3,4-tetrahydroquinoline-4-carbaldehyde |
|---|---|
| PubChem CID | 174449925 |
| Molecular Formula | C10H9FN2O3 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 6-fluoro-8-nitro-1,2,3,4-tetrahydroquinoline-4-carbaldehyde |
| SMILES | O=CC1CCNc2c1cc(F)cc2[N+](=O)[O-] |
| InChI | InChI=1S/C10H9FN2O3/c11-7-3-8-6(5-14)1-2-12-10(8)9(4-7)13(15)16/h3-6,12H,1-2H2 |
| InChIKey | IHOFWMFVOQEOCB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|