C9H9ClN2O3 — CID 15341393
(3S)-7-chloro-3-methyl-5-nitro-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 15341393) has the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. Its IUPAC name is (3S)-7-chloro-3-methyl-5-nitro-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | (3S)-7-chloro-3-methyl-5-nitro-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 15341393 |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | (3S)-7-chloro-3-methyl-5-nitro-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | C[C@H]1COc2cc(Cl)cc([N+](=O)[O-])c2N1 |
| InChI | InChI=1S/C9H9ClN2O3/c1-5-4-15-8-3-6(10)2-7(12(13)14)9(8)11-5/h2-3,5,11H,4H2,1H3/t5-/m0/s1 |
| InChIKey | KSRUXROHBAQLQO-YFKPBYRVSA-N |
| XLogP | 2.44 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|