C22H18N4O10 — CID 175360707
3-[4-(7-carboxy-5-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)but-2-ynyl]-5-nitro-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid (PubChem CID 175360707) has the molecular formula C22H18N4O10 and a molecular weight of 498.40 g/mol. Its IUPAC name is 3-[4-(7-carboxy-5-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)but-2-ynyl]-5-nitro-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid.
| Compound Name | 3-[4-(7-carboxy-5-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)but-2-ynyl]-5-nitro-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 175360707 |
| Molecular Formula | C22H18N4O10 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 3-[4-(7-carboxy-5-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)but-2-ynyl]-5-nitro-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid |
| SMILES | O=C(O)c1cc2c(c([N+](=O)[O-])c1)NC(CC#CCC1COc3cc(C(=O)O)cc([N+](=O)[O-])c3N1)CO2 |
| InChI | InChI=1S/C22H18N4O10/c27-21(28)11-5-15(25(31)32)19-17(7-11)35-9-13(23-19)3-1-2-4-14-10-36-18-8-12(22(29)30)6-16(26(33)34)20(18)24-14/h5-8,13-14,23-24H,3-4,9-10H2,(H,27,28)(H,29,30) |
| InChIKey | UUONLXTXWLEIJU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 203.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|