C14H18N4O6S — CID 146472441
(3R)-5-nitro-3-[[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonamide (PubChem CID 146472441) has the molecular formula C14H18N4O6S and a molecular weight of 370.39 g/mol. Its IUPAC name is (3R)-5-nitro-3-[[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonamide.
| Compound Name | (3R)-5-nitro-3-[[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 146472441 |
| Molecular Formula | C14H18N4O6S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (3R)-5-nitro-3-[[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methyl]-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(c([N+](=O)[O-])c1)N[C@H](CN1C[C@@H]3C[C@H]1CO3)CO2 |
| InChI | InChI=1S/C14H18N4O6S/c15-25(21,22)11-2-12(18(19)20)14-13(3-11)24-6-8(16-14)4-17-5-10-1-9(17)7-23-10/h2-3,8-10,16H,1,4-7H2,(H2,15,21,22)/t8-,9+,10+/m1/s1 |
| InChIKey | QVPQZKBEFQVRIJ-UTLUCORTSA-N |
| XLogP | -0.11 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|