C14H20N4O5S — CID 67126387
4-[methyl-[(3S)-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 67126387) has the molecular formula C14H20N4O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is 4-[methyl-[(3S)-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[methyl-[(3S)-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67126387 |
| Molecular Formula | C14H20N4O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 4-[methyl-[(3S)-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CN(c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])[C@H]1CCN(C2COC2)C1 |
| InChI | InChI=1S/C14H20N4O5S/c1-16(10-4-5-17(7-10)11-8-23-9-11)13-3-2-12(24(15,21)22)6-14(13)18(19)20/h2-3,6,10-11H,4-5,7-9H2,1H3,(H2,15,21,22)/t10-/m0/s1 |
| InChIKey | XUIXJHHSSUSCBX-JTQLQIEISA-N |
| XLogP | 0.15 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|