C14H21N3O5S — CID 67126671
4-[(4-hydroxy-4-methylcyclohexyl)-methylamino]-3-nitrobenzenesulfonamide (PubChem CID 67126671) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-[(4-hydroxy-4-methylcyclohexyl)-methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(4-hydroxy-4-methylcyclohexyl)-methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67126671 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[(4-hydroxy-4-methylcyclohexyl)-methylamino]-3-nitrobenzenesulfonamide |
| SMILES | CN(c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])C1CCC(C)(O)CC1 |
| InChI | InChI=1S/C14H21N3O5S/c1-14(18)7-5-10(6-8-14)16(2)12-4-3-11(23(15,21)22)9-13(12)17(19)20/h3-4,9-10,18H,5-8H2,1-2H3,(H2,15,21,22) |
| InChIKey | AFGAYPOKVFVSQC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|