C10H14N4O4S — CID 66181631
4-[azetidin-3-yl(methyl)amino]-3-nitrobenzenesulfonamide (PubChem CID 66181631) has the molecular formula C10H14N4O4S and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-[azetidin-3-yl(methyl)amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[azetidin-3-yl(methyl)amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 66181631 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-[azetidin-3-yl(methyl)amino]-3-nitrobenzenesulfonamide |
| SMILES | CN(c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])C1CNC1 |
| InChI | InChI=1S/C10H14N4O4S/c1-13(7-5-12-6-7)9-3-2-8(19(11,17)18)4-10(9)14(15)16/h2-4,7,12H,5-6H2,1H3,(H2,11,17,18) |
| InChIKey | WCABFVAEWRQZQV-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|