C12H18N4O7S2 — CID 67126438
4-[methyl-(4-methylsulfonylmorpholin-2-yl)amino]-3-nitrobenzenesulfonamide (PubChem CID 67126438) has the molecular formula C12H18N4O7S2 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[methyl-(4-methylsulfonylmorpholin-2-yl)amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[methyl-(4-methylsulfonylmorpholin-2-yl)amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67126438 |
| Molecular Formula | C12H18N4O7S2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 4-[methyl-(4-methylsulfonylmorpholin-2-yl)amino]-3-nitrobenzenesulfonamide |
| SMILES | CN(c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])C1CN(S(C)(=O)=O)CCO1 |
| InChI | InChI=1S/C12H18N4O7S2/c1-14(12-8-15(5-6-23-12)24(2,19)20)10-4-3-9(25(13,21)22)7-11(10)16(17)18/h3-4,7,12H,5-6,8H2,1-2H3,(H2,13,21,22) |
| InChIKey | PCXGRMXSGIXIIE-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 153.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|