C13H17N5O5S — CID 87279466
4-[[4-(cyanomethyl)morpholin-2-yl]-methylamino]-3-nitrobenzenesulfonamide (PubChem CID 87279466) has the molecular formula C13H17N5O5S and a molecular weight of 355.38 g/mol. Its IUPAC name is 4-[[4-(cyanomethyl)morpholin-2-yl]-methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[4-(cyanomethyl)morpholin-2-yl]-methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 87279466 |
| Molecular Formula | C13H17N5O5S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 4-[[4-(cyanomethyl)morpholin-2-yl]-methylamino]-3-nitrobenzenesulfonamide |
| SMILES | CN(c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])C1CN(CC#N)CCO1 |
| InChI | InChI=1S/C13H17N5O5S/c1-16(13-9-17(5-4-14)6-7-23-13)11-3-2-10(24(15,21)22)8-12(11)18(19)20/h2-3,8,13H,5-7,9H2,1H3,(H2,15,21,22) |
| InChIKey | AYDWVDFJBDJWHN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 142.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|