C10H13N3O6S — CID 62637022
2-(N-methyl-2-nitro-4-sulfamoylanilino)propanoic acid (PubChem CID 62637022) has the molecular formula C10H13N3O6S and a molecular weight of 303.30 g/mol. Its IUPAC name is 2-(N-methyl-2-nitro-4-sulfamoylanilino)propanoic acid.
| Compound Name | 2-(N-methyl-2-nitro-4-sulfamoylanilino)propanoic acid |
|---|---|
| PubChem CID | 62637022 |
| Molecular Formula | C10H13N3O6S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-(N-methyl-2-nitro-4-sulfamoylanilino)propanoic acid |
| SMILES | CC(C(=O)O)N(C)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O6S/c1-6(10(14)15)12(2)8-4-3-7(20(11,18)19)5-9(8)13(16)17/h3-6H,1-2H3,(H,14,15)(H2,11,18,19) |
| InChIKey | APSCGSHHGUHIAJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|