C16H16N4O4S2 — CID 9025721
4-[[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-3-nitrobenzenesulfonamide (PubChem CID 9025721) has the molecular formula C16H16N4O4S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-[[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9025721 |
| Molecular Formula | C16H16N4O4S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4-[[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-3-nitrobenzenesulfonamide |
| SMILES | C[C@@H](c1nc2ccccc2s1)N(C)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N4O4S2/c1-10(16-18-12-5-3-4-6-15(12)25-16)19(2)13-8-7-11(26(17,23)24)9-14(13)20(21)22/h3-10H,1-2H3,(H2,17,23,24)/t10-/m0/s1 |
| InChIKey | VWDRVHRFCSMGFL-JTQLQIEISA-N |
| XLogP | 3.05 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|