C17H17N3O4S2 — CID 8802221
N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-N,4-dimethyl-3-nitrobenzenesulfonamide (PubChem CID 8802221) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-N,4-dimethyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-N,4-dimethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 8802221 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-N,4-dimethyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)[C@@H](C)c2nc3ccccc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O4S2/c1-11-8-9-13(10-15(11)20(21)22)26(23,24)19(3)12(2)17-18-14-6-4-5-7-16(14)25-17/h4-10,12H,1-3H3/t12-/m0/s1 |
| InChIKey | FHOZMDUXZKIGLM-LBPRGKRZSA-N |
| XLogP | 3.89 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|