C15H12FN3O4S2 — CID 9189911
N-(1,3-benzothiazol-2-ylmethyl)-4-fluoro-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 9189911) has the molecular formula C15H12FN3O4S2 and a molecular weight of 381.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-fluoro-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-fluoro-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9189911 |
| Molecular Formula | C15H12FN3O4S2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-fluoro-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CN(Cc1nc2ccccc2s1)S(=O)(=O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12FN3O4S2/c1-18(9-15-17-12-4-2-3-5-14(12)24-15)25(22,23)10-6-7-11(16)13(8-10)19(20)21/h2-8H,9H2,1H3 |
| InChIKey | VIXQTJAWGVLNCT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|