C17H18N2O2S2 — CID 9189865
N-(1,3-benzothiazol-2-ylmethyl)-N,3,4-trimethylbenzenesulfonamide (PubChem CID 9189865) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-N,3,4-trimethylbenzenesulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-N,3,4-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 9189865 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-N,3,4-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2nc3ccccc3s2)cc1C |
| InChI | InChI=1S/C17H18N2O2S2/c1-12-8-9-14(10-13(12)2)23(20,21)19(3)11-17-18-15-6-4-5-7-16(15)22-17/h4-10H,11H2,1-3H3 |
| InChIKey | NECKCANLFKWECP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |