C15H23N5O6S — CID 67126431
4-[[(2R)-4-[2-(dimethylamino)acetyl]morpholin-2-yl]methylamino]-3-nitrobenzenesulfonamide (PubChem CID 67126431) has the molecular formula C15H23N5O6S and a molecular weight of 401.45 g/mol. Its IUPAC name is 4-[[(2R)-4-[2-(dimethylamino)acetyl]morpholin-2-yl]methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(2R)-4-[2-(dimethylamino)acetyl]morpholin-2-yl]methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67126431 |
| Molecular Formula | C15H23N5O6S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[[(2R)-4-[2-(dimethylamino)acetyl]morpholin-2-yl]methylamino]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CC(=O)N1CCO[C@H](CNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H23N5O6S/c1-18(2)10-15(21)19-5-6-26-11(9-19)8-17-13-4-3-12(27(16,24)25)7-14(13)20(22)23/h3-4,7,11,17H,5-6,8-10H2,1-2H3,(H2,16,24,25)/t11-/m1/s1 |
| InChIKey | FTXWAHVZNJXVRL-LLVKDONJSA-N |
| XLogP | -0.56 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|