C17H26N4O6S — CID 162424308
4-[3-[4-(2-methylpropanoyl)morpholin-2-yl]propylamino]-3-nitrobenzenesulfonamide (PubChem CID 162424308) has the molecular formula C17H26N4O6S and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-[3-[4-(2-methylpropanoyl)morpholin-2-yl]propylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[3-[4-(2-methylpropanoyl)morpholin-2-yl]propylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 162424308 |
| Molecular Formula | C17H26N4O6S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-[3-[4-(2-methylpropanoyl)morpholin-2-yl]propylamino]-3-nitrobenzenesulfonamide |
| SMILES | CC(C)C(=O)N1CCOC(CCCNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H26N4O6S/c1-12(2)17(22)20-8-9-27-13(11-20)4-3-7-19-15-6-5-14(28(18,25)26)10-16(15)21(23)24/h5-6,10,12-13,19H,3-4,7-9,11H2,1-2H3,(H2,18,25,26) |
| InChIKey | ALWHSDQZXHUVDC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|