C14H20F2N4O5S — CID 67126992
4-[[4-(1,3-difluoropropan-2-yl)morpholin-2-yl]-methylamino]-3-nitrobenzenesulfonamide (PubChem CID 67126992) has the molecular formula C14H20F2N4O5S and a molecular weight of 394.40 g/mol. Its IUPAC name is 4-[[4-(1,3-difluoropropan-2-yl)morpholin-2-yl]-methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[4-(1,3-difluoropropan-2-yl)morpholin-2-yl]-methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67126992 |
| Molecular Formula | C14H20F2N4O5S |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4-[[4-(1,3-difluoropropan-2-yl)morpholin-2-yl]-methylamino]-3-nitrobenzenesulfonamide |
| SMILES | CN(c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])C1CN(C(CF)CF)CCO1 |
| InChI | InChI=1S/C14H20F2N4O5S/c1-18(14-9-19(4-5-25-14)10(7-15)8-16)12-3-2-11(26(17,23)24)6-13(12)20(21)22/h2-3,6,10,14H,4-5,7-9H2,1H3,(H2,17,23,24) |
| InChIKey | BIWRBDOVXIQZIG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|