C15H22BrN3O6S — CID 146472447
3-bromo-4-[[(1R)-2-hydroxy-1-(4-hydroxy-4-methylcyclohexyl)ethyl]amino]-5-nitrobenzenesulfonamide (PubChem CID 146472447) has the molecular formula C15H22BrN3O6S and a molecular weight of 452.33 g/mol. Its IUPAC name is 3-bromo-4-[[(1R)-2-hydroxy-1-(4-hydroxy-4-methylcyclohexyl)ethyl]amino]-5-nitrobenzenesulfonamide.
| Compound Name | 3-bromo-4-[[(1R)-2-hydroxy-1-(4-hydroxy-4-methylcyclohexyl)ethyl]amino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 146472447 |
| Molecular Formula | C15H22BrN3O6S |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 3-bromo-4-[[(1R)-2-hydroxy-1-(4-hydroxy-4-methylcyclohexyl)ethyl]amino]-5-nitrobenzenesulfonamide |
| SMILES | CC1(O)CCC([C@H](CO)Nc2c(Br)cc(S(N)(=O)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H22BrN3O6S/c1-15(21)4-2-9(3-5-15)12(8-20)18-14-11(16)6-10(26(17,24)25)7-13(14)19(22)23/h6-7,9,12,18,20-21H,2-5,8H2,1H3,(H2,17,24,25)/t9?,12-,15?/m0/s1 |
| InChIKey | WNIMPPFBFBTITC-RHJSQNMRSA-N |
| XLogP | 1.72 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|