C12H18N4O7S — CID 21320411
4-(5-hydroxyhexan-3-ylamino)-3,5-dinitrobenzenesulfonamide (PubChem CID 21320411) has the molecular formula C12H18N4O7S and a molecular weight of 362.36 g/mol. Its IUPAC name is 4-(5-hydroxyhexan-3-ylamino)-3,5-dinitrobenzenesulfonamide.
| Compound Name | 4-(5-hydroxyhexan-3-ylamino)-3,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 21320411 |
| Molecular Formula | C12H18N4O7S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-(5-hydroxyhexan-3-ylamino)-3,5-dinitrobenzenesulfonamide |
| SMILES | CCC(CC(C)O)Nc1c([N+](=O)[O-])cc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O7S/c1-3-8(4-7(2)17)14-12-10(15(18)19)5-9(24(13,22)23)6-11(12)16(20)21/h5-8,14,17H,3-4H2,1-2H3,(H2,13,22,23) |
| InChIKey | FXDOWUYTXRRYDU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 178.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|