C11H12N3O6- — CID 7103888
4-[[(2R)-butan-2-yl]amino]-3,5-dinitrobenzoate (PubChem CID 7103888) has the molecular formula C11H12N3O6- and a molecular weight of 282.23 g/mol. Its IUPAC name is 4-[[(2R)-butan-2-yl]amino]-3,5-dinitrobenzoate.
| Compound Name | 4-[[(2R)-butan-2-yl]amino]-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 7103888 |
| Molecular Formula | C11H12N3O6- |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4-[[(2R)-butan-2-yl]amino]-3,5-dinitrobenzoate |
| SMILES | CC[C@@H](C)Nc1c([N+](=O)[O-])cc(C(=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O6/c1-3-6(2)12-10-8(13(17)18)4-7(11(15)16)5-9(10)14(19)20/h4-6,12H,3H2,1-2H3,(H,15,16)/p-1/t6-/m1/s1 |
| InChIKey | CJQGADOPJHJTTA-ZCFIWIBFSA-M |
| XLogP | 1.08 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|