C15H23N3O5 — CID 154125076
N-butan-2-yl-3-(ethoxymethyl)-4-ethyl-2,6-dinitroaniline (PubChem CID 154125076) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-butan-2-yl-3-(ethoxymethyl)-4-ethyl-2,6-dinitroaniline.
| Compound Name | N-butan-2-yl-3-(ethoxymethyl)-4-ethyl-2,6-dinitroaniline |
|---|---|
| PubChem CID | 154125076 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-butan-2-yl-3-(ethoxymethyl)-4-ethyl-2,6-dinitroaniline |
| SMILES | CCOCc1c(CC)cc([N+](=O)[O-])c(NC(C)CC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N3O5/c1-5-10(4)16-14-13(17(19)20)8-11(6-2)12(9-23-7-3)15(14)18(21)22/h8,10,16H,5-7,9H2,1-4H3 |
| InChIKey | OVUYLOLHIGYBSQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|