C20H36N2 — CID 87460375
1-N,3-N-di(butan-2-yl)-2,4,6-triethylbenzene-1,3-diamine (PubChem CID 87460375) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-N,3-N-di(butan-2-yl)-2,4,6-triethylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-di(butan-2-yl)-2,4,6-triethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 87460375 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 1-N,3-N-di(butan-2-yl)-2,4,6-triethylbenzene-1,3-diamine |
| SMILES | CCc1cc(CC)c(NC(C)CC)c(CC)c1NC(C)CC |
| InChI | InChI=1S/C20H36N2/c1-8-14(6)21-19-16(10-3)13-17(11-4)20(18(19)12-5)22-15(7)9-2/h13-15,21-22H,8-12H2,1-7H3 |
| InChIKey | QQVCDQQXEIVVGJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |