C13H19N3O2 — CID 140538451
2-[[(2R)-butan-2-yl]amino]-3-methylbenzene-1,4-dicarboxamide (PubChem CID 140538451) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[[(2R)-butan-2-yl]amino]-3-methylbenzene-1,4-dicarboxamide.
| Compound Name | 2-[[(2R)-butan-2-yl]amino]-3-methylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 140538451 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-[[(2R)-butan-2-yl]amino]-3-methylbenzene-1,4-dicarboxamide |
| SMILES | CC[C@@H](C)Nc1c(C(N)=O)ccc(C(N)=O)c1C |
| InChI | InChI=1S/C13H19N3O2/c1-4-7(2)16-11-8(3)9(12(14)17)5-6-10(11)13(15)18/h5-7,16H,4H2,1-3H3,(H2,14,17)(H2,15,18)/t7-/m1/s1 |
| InChIKey | MVYNYNNKZRGHOB-SSDOTTSWSA-N |
| XLogP | 1.40 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |