C12H17N3O2 — CID 140538473
2-[[(2R)-butan-2-yl]amino]benzene-1,4-dicarboxamide (PubChem CID 140538473) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-[[(2R)-butan-2-yl]amino]benzene-1,4-dicarboxamide.
| Compound Name | 2-[[(2R)-butan-2-yl]amino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 140538473 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-[[(2R)-butan-2-yl]amino]benzene-1,4-dicarboxamide |
| SMILES | CC[C@@H](C)Nc1cc(C(N)=O)ccc1C(N)=O |
| InChI | InChI=1S/C12H17N3O2/c1-3-7(2)15-10-6-8(11(13)16)4-5-9(10)12(14)17/h4-7,15H,3H2,1-2H3,(H2,13,16)(H2,14,17)/t7-/m1/s1 |
| InChIKey | WTZNYILYRCSNCT-SSDOTTSWSA-N |
| XLogP | 1.09 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |