C15H12N3O6- — CID 7183810
4-(3,4-dimethylanilino)-3,5-dinitrobenzoate (PubChem CID 7183810) has the molecular formula C15H12N3O6- and a molecular weight of 330.28 g/mol. Its IUPAC name is 4-(3,4-dimethylanilino)-3,5-dinitrobenzoate.
| Compound Name | 4-(3,4-dimethylanilino)-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 7183810 |
| Molecular Formula | C15H12N3O6- |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 4-(3,4-dimethylanilino)-3,5-dinitrobenzoate |
| SMILES | Cc1ccc(Nc2c([N+](=O)[O-])cc(C(=O)[O-])cc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H13N3O6/c1-8-3-4-11(5-9(8)2)16-14-12(17(21)22)6-10(15(19)20)7-13(14)18(23)24/h3-7,16H,1-2H3,(H,19,20)/p-1 |
| InChIKey | AACJWVBOCTXKHN-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|