C15H15N3O3 — CID 4876320
4-(3,4-dimethylanilino)-3-nitrobenzamide (PubChem CID 4876320) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 4-(3,4-dimethylanilino)-3-nitrobenzamide.
| Compound Name | 4-(3,4-dimethylanilino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 4876320 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-(3,4-dimethylanilino)-3-nitrobenzamide |
| SMILES | Cc1ccc(Nc2ccc(C(N)=O)cc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H15N3O3/c1-9-3-5-12(7-10(9)2)17-13-6-4-11(15(16)19)8-14(13)18(20)21/h3-8,17H,1-2H3,(H2,16,19) |
| InChIKey | OFQCFCFKVQZPPG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|