C19H23N3O4S — CID 133315995
N-methyl-N-(4-methylsulfonyl-2-nitrophenyl)-1-phenylpiperidin-3-amine (PubChem CID 133315995) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-methyl-N-(4-methylsulfonyl-2-nitrophenyl)-1-phenylpiperidin-3-amine.
| Compound Name | N-methyl-N-(4-methylsulfonyl-2-nitrophenyl)-1-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 133315995 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-methyl-N-(4-methylsulfonyl-2-nitrophenyl)-1-phenylpiperidin-3-amine |
| SMILES | CN(c1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])C1CCCN(c2ccccc2)C1 |
| InChI | InChI=1S/C19H23N3O4S/c1-20(16-9-6-12-21(14-16)15-7-4-3-5-8-15)18-11-10-17(27(2,25)26)13-19(18)22(23)24/h3-5,7-8,10-11,13,16H,6,9,12,14H2,1-2H3 |
| InChIKey | UIQUCHXMXSSQGV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|