C11H14N2O8S2 — CID 160649851
[(3S)-5-nitro-7-sulfamoyl-3,4-dihydro-2H-chromen-3-yl]methyl methanesulfonate (PubChem CID 160649851) has the molecular formula C11H14N2O8S2 and a molecular weight of 366.37 g/mol. Its IUPAC name is [(3S)-5-nitro-7-sulfamoyl-3,4-dihydro-2H-chromen-3-yl]methyl methanesulfonate.
| Compound Name | [(3S)-5-nitro-7-sulfamoyl-3,4-dihydro-2H-chromen-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 160649851 |
| Molecular Formula | C11H14N2O8S2 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | [(3S)-5-nitro-7-sulfamoyl-3,4-dihydro-2H-chromen-3-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1COc2cc(S(N)(=O)=O)cc([N+](=O)[O-])c2C1 |
| InChI | InChI=1S/C11H14N2O8S2/c1-22(16,17)21-6-7-2-9-10(13(14)15)3-8(23(12,18)19)4-11(9)20-5-7/h3-4,7H,2,5-6H2,1H3,(H2,12,18,19)/t7-/m0/s1 |
| InChIKey | RKGUUYWGKQIYRQ-ZETCQYMHSA-N |
| XLogP | -0.23 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|