About 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride
4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride (PubChem CID 175349898) has the molecular formula C12H17Cl3N2O5Ti
and a molecular weight of 423.50 g/mol. Its IUPAC name is 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride.
Molecular Properties
| Compound Name | 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride |
| PubChem CID | 175349898 |
| Molecular Formula | C12H17Cl3N2O5Ti |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride |
| SMILES | CCCC(=O)Nc1c(C)cc(C(=O)O)cc1[N+](=O)[O-].Cl.Cl.Cl.[Ti] |
| InChI | InChI=1S/C12H14N2O5.3ClH.Ti/c1-3-4-10(15)13-11-7(2)5-8(12(16)17)6-9(11)14(18)19;;;;/h5-6H,3-4H2,1-2H3,(H,13,15)(H,16,17);3*1H; |
| InChIKey | GRUKLQCCNMCCID-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride?
The IUPAC name of 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride (CID 175349898) is 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride.
What is the SMILES notation for 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride?
The canonical SMILES for 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride is CCCC(=O)Nc1c(C)cc(C(=O)O)cc1[N+](=O)[O-].Cl.Cl.Cl.[Ti].
What is the InChIKey of 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride?
The InChIKey is GRUKLQCCNMCCID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O5.3ClH.Ti/c1-3-4-10(15)13-11-7(2)5-8(12(16)17)6-9(11)14(18)19;;;;/h5-6H,3-4H2,1-2H3,(H,13,15)(H,16,17);3*1H;.
What are the key properties of 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride?
4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride has a molecular weight of 423.50 g/mol, XLogP of 3.60, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid;titanium;trihydrochloride is sourced from PubChem (CID 175349898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).