C10H12N2O5S — CID 139628405
methyl 3-(butanoylamino)-4-nitrothiophene-2-carboxylate (PubChem CID 139628405) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is methyl 3-(butanoylamino)-4-nitrothiophene-2-carboxylate.
| Compound Name | methyl 3-(butanoylamino)-4-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 139628405 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | methyl 3-(butanoylamino)-4-nitrothiophene-2-carboxylate |
| SMILES | CCCC(=O)Nc1c([N+](=O)[O-])csc1C(=O)OC |
| InChI | InChI=1S/C10H12N2O5S/c1-3-4-7(13)11-8-6(12(15)16)5-18-9(8)10(14)17-2/h5H,3-4H2,1-2H3,(H,11,13) |
| InChIKey | IYXFSHSBKBCFOY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|