C14H12BrNO3S — CID 176893694
methyl 4-bromo-3-[(2-phenylacetyl)amino]thiophene-2-carboxylate (PubChem CID 176893694) has the molecular formula C14H12BrNO3S and a molecular weight of 354.23 g/mol. Its IUPAC name is methyl 4-bromo-3-[(2-phenylacetyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 4-bromo-3-[(2-phenylacetyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 176893694 |
| Molecular Formula | C14H12BrNO3S |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | methyl 4-bromo-3-[(2-phenylacetyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(Br)c1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H12BrNO3S/c1-19-14(18)13-12(10(15)8-20-13)16-11(17)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,16,17) |
| InChIKey | MKFFYBZLTUPJFR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |