C7H5BrO4S — CID 67232935
4-bromo-2-methoxycarbonylthiophene-3-carboxylic acid (PubChem CID 67232935) has the molecular formula C7H5BrO4S and a molecular weight of 265.08 g/mol. Its IUPAC name is 4-bromo-2-methoxycarbonylthiophene-3-carboxylic acid.
| Compound Name | 4-bromo-2-methoxycarbonylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 67232935 |
| Molecular Formula | C7H5BrO4S |
| Molecular Weight | 265.08 g/mol |
| Exact Mass | 263.91 |
| IUPAC Name | 4-bromo-2-methoxycarbonylthiophene-3-carboxylic acid |
| SMILES | COC(=O)c1scc(Br)c1C(=O)O |
| InChI | InChI=1S/C7H5BrO4S/c1-12-7(11)5-4(6(9)10)3(8)2-13-5/h2H,1H3,(H,9,10) |
| InChIKey | ZKBKHHMPDNMZEI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.08 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |