C9H10O4S — CID 673684
dimethyl 3-methylthiophene-2,4-dicarboxylate (PubChem CID 673684) has the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. Its IUPAC name is dimethyl 3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 673684 |
| Molecular Formula | C9H10O4S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | dimethyl 3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1csc(C(=O)OC)c1C |
| InChI | InChI=1S/C9H10O4S/c1-5-6(8(10)12-2)4-14-7(5)9(11)13-3/h4H,1-3H3 |
| InChIKey | RSYMPAMELGIPOR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |