C19H29NO5S — CID 144740528
tert-butyl carbamate;methyl 5-(cyclohexanecarbonyl)-4-methylthiophene-3-carboxylate (PubChem CID 144740528) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is tert-butyl carbamate;methyl 5-(cyclohexanecarbonyl)-4-methylthiophene-3-carboxylate.
| Compound Name | tert-butyl carbamate;methyl 5-(cyclohexanecarbonyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 144740528 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl carbamate;methyl 5-(cyclohexanecarbonyl)-4-methylthiophene-3-carboxylate |
| SMILES | CC(C)(C)OC(N)=O.COC(=O)c1csc(C(=O)C2CCCCC2)c1C |
| InChI | InChI=1S/C14H18O3S.C5H11NO2/c1-9-11(14(16)17-2)8-18-13(9)12(15)10-6-4-3-5-7-10;1-5(2,3)8-4(6)7/h8,10H,3-7H2,1-2H3;1-3H3,(H2,6,7) |
| InChIKey | HRQCGEJTTCWMEG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |