C11H14OS — CID 130815499
cyclobutyl-(4,5-dimethylthiophen-3-yl)methanone (PubChem CID 130815499) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is cyclobutyl-(4,5-dimethylthiophen-3-yl)methanone.
| Compound Name | cyclobutyl-(4,5-dimethylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 130815499 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | cyclobutyl-(4,5-dimethylthiophen-3-yl)methanone |
| SMILES | Cc1scc(C(=O)C2CCC2)c1C |
| InChI | InChI=1S/C11H14OS/c1-7-8(2)13-6-10(7)11(12)9-4-3-5-9/h6,9H,3-5H2,1-2H3 |
| InChIKey | FYPLOBHUDUKQSY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |