C13H17ClOS — CID 103407872
(3-chloro-4-methylthiophen-2-yl)-cycloheptylmethanone (PubChem CID 103407872) has the molecular formula C13H17ClOS and a molecular weight of 256.80 g/mol. Its IUPAC name is (3-chloro-4-methylthiophen-2-yl)-cycloheptylmethanone.
| Compound Name | (3-chloro-4-methylthiophen-2-yl)-cycloheptylmethanone |
|---|---|
| PubChem CID | 103407872 |
| Molecular Formula | C13H17ClOS |
| Molecular Weight | 256.80 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (3-chloro-4-methylthiophen-2-yl)-cycloheptylmethanone |
| SMILES | Cc1csc(C(=O)C2CCCCCC2)c1Cl |
| InChI | InChI=1S/C13H17ClOS/c1-9-8-16-13(11(9)14)12(15)10-6-4-2-3-5-7-10/h8,10H,2-7H2,1H3 |
| InChIKey | IXBMEPDFDIQFTG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |