C14H19ClN2OS2 — CID 103401768
N-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-3-chloro-4-methylthiophene-2-carboxamide (PubChem CID 103401768) has the molecular formula C14H19ClN2OS2 and a molecular weight of 330.91 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-3-chloro-4-methylthiophene-2-carboxamide.
| Compound Name | N-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-3-chloro-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103401768 |
| Molecular Formula | C14H19ClN2OS2 |
| Molecular Weight | 330.91 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-3-chloro-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)NC(C(N)=S)C2CCCCC2)c1Cl |
| InChI | InChI=1S/C14H19ClN2OS2/c1-8-7-20-12(10(8)15)14(18)17-11(13(16)19)9-5-3-2-4-6-9/h7,9,11H,2-6H2,1H3,(H2,16,19)(H,17,18) |
| InChIKey | QKQUOVRVALTEFU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|