C13H16Br2OS — CID 79602537
cyclooctyl-(3,4-dibromothiophen-2-yl)methanone (PubChem CID 79602537) has the molecular formula C13H16Br2OS and a molecular weight of 380.15 g/mol. Its IUPAC name is cyclooctyl-(3,4-dibromothiophen-2-yl)methanone.
| Compound Name | cyclooctyl-(3,4-dibromothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 79602537 |
| Molecular Formula | C13H16Br2OS |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | cyclooctyl-(3,4-dibromothiophen-2-yl)methanone |
| SMILES | O=C(c1scc(Br)c1Br)C1CCCCCCC1 |
| InChI | InChI=1S/C13H16Br2OS/c14-10-8-17-13(11(10)15)12(16)9-6-4-2-1-3-5-7-9/h8-9H,1-7H2 |
| InChIKey | YZGDYJVUHSRJMX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |