C16H23NO3S — CID 123337673
methyl 4-methyl-5-(5-morpholin-4-ylpent-2-en-3-yl)thiophene-3-carboxylate (PubChem CID 123337673) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is methyl 4-methyl-5-(5-morpholin-4-ylpent-2-en-3-yl)thiophene-3-carboxylate.
| Compound Name | methyl 4-methyl-5-(5-morpholin-4-ylpent-2-en-3-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 123337673 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | methyl 4-methyl-5-(5-morpholin-4-ylpent-2-en-3-yl)thiophene-3-carboxylate |
| SMILES | CC=C(CCN1CCOCC1)c1scc(C(=O)OC)c1C |
| InChI | InChI=1S/C16H23NO3S/c1-4-13(5-6-17-7-9-20-10-8-17)15-12(2)14(11-21-15)16(18)19-3/h4,11H,5-10H2,1-3H3 |
| InChIKey | RNATZOZBJSMETD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |