C17H24O4S — CID 145071529
methyl 5-[1-(4-hydroxy-4-methoxycyclohexylidene)propyl]-4-methylthiophene-3-carboxylate (PubChem CID 145071529) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is methyl 5-[1-(4-hydroxy-4-methoxycyclohexylidene)propyl]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-[1-(4-hydroxy-4-methoxycyclohexylidene)propyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 145071529 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | methyl 5-[1-(4-hydroxy-4-methoxycyclohexylidene)propyl]-4-methylthiophene-3-carboxylate |
| SMILES | CCC(=C1CCC(O)(OC)CC1)c1scc(C(=O)OC)c1C |
| InChI | InChI=1S/C17H24O4S/c1-5-13(12-6-8-17(19,21-4)9-7-12)15-11(2)14(10-22-15)16(18)20-3/h10,19H,5-9H2,1-4H3/b13-12- |
| InChIKey | AJMKTRIMVSWXGL-SEYXRHQNSA-N |
| XLogP | 3.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|