C19H29NO2S — CID 157104482
methyl 5-[1-(1-tert-butylpiperidin-4-ylidene)propyl]-4-methylthiophene-3-carboxylate (PubChem CID 157104482) has the molecular formula C19H29NO2S and a molecular weight of 335.51 g/mol. Its IUPAC name is methyl 5-[1-(1-tert-butylpiperidin-4-ylidene)propyl]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-[1-(1-tert-butylpiperidin-4-ylidene)propyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 157104482 |
| Molecular Formula | C19H29NO2S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | methyl 5-[1-(1-tert-butylpiperidin-4-ylidene)propyl]-4-methylthiophene-3-carboxylate |
| SMILES | CCC(=C1CCN(C(C)(C)C)CC1)c1scc(C(=O)OC)c1C |
| InChI | InChI=1S/C19H29NO2S/c1-7-15(14-8-10-20(11-9-14)19(3,4)5)17-13(2)16(12-23-17)18(21)22-6/h12H,7-11H2,1-6H3 |
| InChIKey | AGDKCEDJKKMVAZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |