C18H29NO2S — CID 121305291
methyl 5-[2-(1-tert-butylpiperidin-4-yl)ethyl]-4-methylthiophene-3-carboxylate (PubChem CID 121305291) has the molecular formula C18H29NO2S and a molecular weight of 323.50 g/mol. Its IUPAC name is methyl 5-[2-(1-tert-butylpiperidin-4-yl)ethyl]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-[2-(1-tert-butylpiperidin-4-yl)ethyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 121305291 |
| Molecular Formula | C18H29NO2S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | methyl 5-[2-(1-tert-butylpiperidin-4-yl)ethyl]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1csc(CCC2CCN(C(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C18H29NO2S/c1-13-15(17(20)21-5)12-22-16(13)7-6-14-8-10-19(11-9-14)18(2,3)4/h12,14H,6-11H2,1-5H3 |
| InChIKey | DMAJHDDSXTXDEE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |