C16H22O4S — CID 90948749
dimethyl 4-(2-cyclohexylethyl)thiophene-2,3-dicarboxylate (PubChem CID 90948749) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is dimethyl 4-(2-cyclohexylethyl)thiophene-2,3-dicarboxylate.
| Compound Name | dimethyl 4-(2-cyclohexylethyl)thiophene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 90948749 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | dimethyl 4-(2-cyclohexylethyl)thiophene-2,3-dicarboxylate |
| SMILES | COC(=O)c1scc(CCC2CCCCC2)c1C(=O)OC |
| InChI | InChI=1S/C16H22O4S/c1-19-15(17)13-12(10-21-14(13)16(18)20-2)9-8-11-6-4-3-5-7-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | DHCQFQPTHHHXOO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |