C15H18N2O4 — CID 159072134
1-(7-nitro-5-prop-2-enyl-3,4,5,6-tetrahydro-2H-1,6-benzoxazocin-9-yl)ethanone (PubChem CID 159072134) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-(7-nitro-5-prop-2-enyl-3,4,5,6-tetrahydro-2H-1,6-benzoxazocin-9-yl)ethanone.
| Compound Name | 1-(7-nitro-5-prop-2-enyl-3,4,5,6-tetrahydro-2H-1,6-benzoxazocin-9-yl)ethanone |
|---|---|
| PubChem CID | 159072134 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-(7-nitro-5-prop-2-enyl-3,4,5,6-tetrahydro-2H-1,6-benzoxazocin-9-yl)ethanone |
| SMILES | C=CCC1CCCOc2cc(C(C)=O)cc([N+](=O)[O-])c2N1 |
| InChI | InChI=1S/C15H18N2O4/c1-3-5-12-6-4-7-21-14-9-11(10(2)18)8-13(17(19)20)15(14)16-12/h3,8-9,12,16H,1,4-7H2,2H3 |
| InChIKey | HHSUNJNZVZQANP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|