C17H16N2O4 — CID 40677129
1-[4-[[(4S)-3,4-dihydro-2H-chromen-4-yl]amino]-3-nitrophenyl]ethanone (PubChem CID 40677129) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-[4-[[(4S)-3,4-dihydro-2H-chromen-4-yl]amino]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[[(4S)-3,4-dihydro-2H-chromen-4-yl]amino]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 40677129 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[4-[[(4S)-3,4-dihydro-2H-chromen-4-yl]amino]-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N[C@H]2CCOc3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N2O4/c1-11(20)12-6-7-15(16(10-12)19(21)22)18-14-8-9-23-17-5-3-2-4-13(14)17/h2-7,10,14,18H,8-9H2,1H3/t14-/m0/s1 |
| InChIKey | FOGSRTNXCKQSPT-AWEZNQCLSA-N |
| XLogP | 3.73 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|