C22H25N3O4 — CID 39911963
1-[4-[[(4R)-1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-yl]amino]-3-nitrophenyl]ethanone (PubChem CID 39911963) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[4-[[(4R)-1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-yl]amino]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[[(4R)-1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-yl]amino]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 39911963 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[4-[[(4R)-1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-yl]amino]-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N[C@@H]2CC3(CCN(C)CC3)Oc3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25N3O4/c1-15(26)16-7-8-18(20(13-16)25(27)28)23-19-14-22(9-11-24(2)12-10-22)29-21-6-4-3-5-17(19)21/h3-8,13,19,23H,9-12,14H2,1-2H3/t19-/m1/s1 |
| InChIKey | AXNAFCFUMJUXQG-LJQANCHMSA-N |
| XLogP | 4.20 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|